C24H32F3NO3S — CID 154063137
8-butyl-6-propyl-7-[4-(1,3-thiazolidin-3-yl)butoxy]-4-(trifluoromethyl)chromen-2-one (PubChem CID 154063137) has the molecular formula C24H32F3NO3S and a molecular weight of 471.59 g/mol. Its IUPAC name is 8-butyl-6-propyl-7-[4-(1,3-thiazolidin-3-yl)butoxy]-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 8-butyl-6-propyl-7-[4-(1,3-thiazolidin-3-yl)butoxy]-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 154063137 |
| Molecular Formula | C24H32F3NO3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 8-butyl-6-propyl-7-[4-(1,3-thiazolidin-3-yl)butoxy]-4-(trifluoromethyl)chromen-2-one |
| SMILES | CCCCc1c(OCCCCN2CCSC2)c(CCC)cc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C24H32F3NO3S/c1-3-5-9-18-22(30-12-7-6-10-28-11-13-32-16-28)17(8-4-2)14-19-20(24(25,26)27)15-21(29)31-23(18)19/h14-15H,3-13,16H2,1-2H3 |
| InChIKey | QQVPQAGXAFWOBJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|