C31H37F3N2O5 — CID 88954582
N-[methyl(1-phenylethyl)carbamoyl]-N-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]formamide (PubChem CID 88954582) has the molecular formula C31H37F3N2O5 and a molecular weight of 574.64 g/mol. Its IUPAC name is N-[methyl(1-phenylethyl)carbamoyl]-N-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]formamide.
| Compound Name | N-[methyl(1-phenylethyl)carbamoyl]-N-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]formamide |
|---|---|
| PubChem CID | 88954582 |
| Molecular Formula | C31H37F3N2O5 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | N-[methyl(1-phenylethyl)carbamoyl]-N-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]formamide |
| SMILES | CCCc1cc2c(C(F)(F)F)cc(=O)oc2c(CCC)c1OCCCCN(C=O)C(=O)N(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C31H37F3N2O5/c1-5-12-23-18-25-26(31(32,33)34)19-27(38)41-29(25)24(13-6-2)28(23)40-17-11-10-16-36(20-37)30(39)35(4)21(3)22-14-8-7-9-15-22/h7-9,14-15,18-21H,5-6,10-13,16-17H2,1-4H3 |
| InChIKey | GISQPCCBZMQYII-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|