C23H24F3NO5S — CID 76675816
3-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybut-2-enyl]-1,3-thiazolidine-2,4-dione (PubChem CID 76675816) has the molecular formula C23H24F3NO5S and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybut-2-enyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybut-2-enyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76675816 |
| Molecular Formula | C23H24F3NO5S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-[4-[2-oxo-6,8-dipropyl-4-(trifluoromethyl)chromen-7-yl]oxybut-2-enyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc2c(C(F)(F)F)cc(=O)oc2c(CCC)c1OCC=CCN1C(=O)CSC1=O |
| InChI | InChI=1S/C23H24F3NO5S/c1-3-7-14-11-16-17(23(24,25)26)12-19(29)32-21(16)15(8-4-2)20(14)31-10-6-5-9-27-18(28)13-33-22(27)30/h5-6,11-12H,3-4,7-10,13H2,1-2H3 |
| InChIKey | MNPBDPGGIUFQIV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|