C23H24F6N2O5 — CID 90776894
4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-(2,2,2-trifluoroethyl)imidazol-2-one (PubChem CID 90776894) has the molecular formula C23H24F6N2O5 and a molecular weight of 522.44 g/mol. Its IUPAC name is 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-(2,2,2-trifluoroethyl)imidazol-2-one.
| Compound Name | 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-(2,2,2-trifluoroethyl)imidazol-2-one |
|---|---|
| PubChem CID | 90776894 |
| Molecular Formula | C23H24F6N2O5 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-(2,2,2-trifluoroethyl)imidazol-2-one |
| SMILES | CCCc1c(OCCCCCn2c(O)cn(CC(F)(F)F)c2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C23H24F6N2O5/c1-2-6-15-17(8-7-14-16(23(27,28)29)11-19(33)36-20(14)15)35-10-5-3-4-9-31-18(32)12-30(21(31)34)13-22(24,25)26/h7-8,11-12,32H,2-6,9-10,13H2,1H3 |
| InChIKey | FXLYXITZHVXTKA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|