C14H12ClF3O3 — CID 159075994
7-butoxy-8-chloro-4-(trifluoromethyl)chromen-2-one (PubChem CID 159075994) has the molecular formula C14H12ClF3O3 and a molecular weight of 320.69 g/mol. Its IUPAC name is 7-butoxy-8-chloro-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-butoxy-8-chloro-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 159075994 |
| Molecular Formula | C14H12ClF3O3 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 7-butoxy-8-chloro-4-(trifluoromethyl)chromen-2-one |
| SMILES | CCCCOc1ccc2c(C(F)(F)F)cc(=O)oc2c1Cl |
| InChI | InChI=1S/C14H12ClF3O3/c1-2-3-6-20-10-5-4-8-9(14(16,17)18)7-11(19)21-13(8)12(10)15/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | KAGIUDSLJQJQDL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|