C28H26F6N2O5 — CID 91039668
4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-[3-(trifluoromethyl)phenyl]imidazol-2-one (PubChem CID 91039668) has the molecular formula C28H26F6N2O5 and a molecular weight of 584.51 g/mol. Its IUPAC name is 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-[3-(trifluoromethyl)phenyl]imidazol-2-one.
| Compound Name | 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-[3-(trifluoromethyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 91039668 |
| Molecular Formula | C28H26F6N2O5 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]-1-[3-(trifluoromethyl)phenyl]imidazol-2-one |
| SMILES | CCCc1c(OCCCCCn2c(O)cn(-c3cccc(C(F)(F)F)c3)c2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C28H26F6N2O5/c1-2-7-20-22(11-10-19-21(28(32,33)34)15-24(38)41-25(19)20)40-13-5-3-4-12-35-23(37)16-36(26(35)39)18-9-6-8-17(14-18)27(29,30)31/h6,8-11,14-16,37H,2-5,7,12-13H2,1H3 |
| InChIKey | SWWHDEMVLFSYGX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|