C28H31F3N2O5 — CID 143856029
2-amino-N-formyl-2-(4-methylphenyl)-N-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]propanamide (PubChem CID 143856029) has the molecular formula C28H31F3N2O5 and a molecular weight of 532.56 g/mol. Its IUPAC name is 2-amino-N-formyl-2-(4-methylphenyl)-N-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]propanamide.
| Compound Name | 2-amino-N-formyl-2-(4-methylphenyl)-N-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]propanamide |
|---|---|
| PubChem CID | 143856029 |
| Molecular Formula | C28H31F3N2O5 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-amino-N-formyl-2-(4-methylphenyl)-N-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]propanamide |
| SMILES | CCCc1c(OCCCCN(C=O)C(=O)C(C)(N)c2ccc(C)cc2)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C28H31F3N2O5/c1-4-7-21-23(13-12-20-22(28(29,30)31)16-24(35)38-25(20)21)37-15-6-5-14-33(17-34)26(36)27(3,32)19-10-8-18(2)9-11-19/h8-13,16-17H,4-7,14-15,32H2,1-3H3 |
| InChIKey | PPGDSUNPOATJOC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|