C23H26F3NO5 — CID 90781803
7-[4-(2,5-dihydroxypyrrol-1-yl)butoxy]-8-ethyl-6-propyl-4-(trifluoromethyl)chromen-2-one (PubChem CID 90781803) has the molecular formula C23H26F3NO5 and a molecular weight of 453.46 g/mol. Its IUPAC name is 7-[4-(2,5-dihydroxypyrrol-1-yl)butoxy]-8-ethyl-6-propyl-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-[4-(2,5-dihydroxypyrrol-1-yl)butoxy]-8-ethyl-6-propyl-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 90781803 |
| Molecular Formula | C23H26F3NO5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 7-[4-(2,5-dihydroxypyrrol-1-yl)butoxy]-8-ethyl-6-propyl-4-(trifluoromethyl)chromen-2-one |
| SMILES | CCCc1cc2c(C(F)(F)F)cc(=O)oc2c(CC)c1OCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C23H26F3NO5/c1-3-7-14-12-16-17(23(24,25)26)13-20(30)32-22(16)15(4-2)21(14)31-11-6-5-10-27-18(28)8-9-19(27)29/h8-9,12-13,28-29H,3-7,10-11H2,1-2H3 |
| InChIKey | ZQLHRCQFRSPFJO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|