C32H33F3N2O7 — CID 87480937
5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-methyl-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazolidine-2,4-dione (PubChem CID 87480937) has the molecular formula C32H33F3N2O7 and a molecular weight of 614.62 g/mol. Its IUPAC name is 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-methyl-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazolidine-2,4-dione.
| Compound Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-methyl-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87480937 |
| Molecular Formula | C32H33F3N2O7 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-methyl-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCCCN2C(=O)NC(C)(C3=COC=C(C4=CC=CCC4)O3)C2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C32H33F3N2O7/c1-3-10-22-24(14-13-21-23(32(33,34)35)17-27(38)44-28(21)22)42-16-9-5-8-15-37-29(39)31(2,36-30(37)40)26-19-41-18-25(43-26)20-11-6-4-7-12-20/h4,6,11,13-14,17-19H,3,5,7-10,12,15-16H2,1-2H3,(H,36,40) |
| InChIKey | BBHSQSQOECZNRQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|