C29H31FN2O7 — CID 88954578
5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(fluoromethyl)-2-oxo-8-propylchromen-7-yl]oxybutyl]imidazolidine-2,4-dione (PubChem CID 88954578) has the molecular formula C29H31FN2O7 and a molecular weight of 538.57 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(fluoromethyl)-2-oxo-8-propylchromen-7-yl]oxybutyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(fluoromethyl)-2-oxo-8-propylchromen-7-yl]oxybutyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88954578 |
| Molecular Formula | C29H31FN2O7 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(fluoromethyl)-2-oxo-8-propylchromen-7-yl]oxybutyl]imidazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCCN2C(=O)NC(CC)(c3ccc4c(c3)OCO4)C2=O)ccc2c(CF)cc(=O)oc12 |
| InChI | InChI=1S/C29H31FN2O7/c1-3-7-21-22(11-9-20-18(16-30)14-25(33)39-26(20)21)36-13-6-5-12-32-27(34)29(4-2,31-28(32)35)19-8-10-23-24(15-19)38-17-37-23/h8-11,14-15H,3-7,12-13,16-17H2,1-2H3,(H,31,35) |
| InChIKey | CZVJXARLVRKCLH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|