C33H33F5N2O6 — CID 59234888
5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3-pentafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)phenoxy]butyl]imidazolidine-2,4-dione (PubChem CID 59234888) has the molecular formula C33H33F5N2O6 and a molecular weight of 648.63 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3-pentafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)phenoxy]butyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3-pentafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)phenoxy]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234888 |
| Molecular Formula | C33H33F5N2O6 |
| Molecular Weight | 648.63 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3-pentafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)phenoxy]butyl]imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc3c(c2)OCO3)NC(=O)N(CCCCOc2ccc(C(O)(C(F)F)C(F)(F)F)cc2CCc2ccccc2)C1=O |
| InChI | InChI=1S/C33H33F5N2O6/c1-2-31(23-12-15-26-27(19-23)46-20-45-26)29(41)40(30(42)39-31)16-6-7-17-44-25-14-13-24(32(43,28(34)35)33(36,37)38)18-22(25)11-10-21-8-4-3-5-9-21/h3-5,8-9,12-15,18-19,28,43H,2,6-7,10-11,16-17,20H2,1H3,(H,39,42) |
| InChIKey | VUYFXCKAVABAAK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|