C24H32F6N2O4 — CID 59235172
5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2-propylphenoxy]butyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 59235172) has the molecular formula C24H32F6N2O4 and a molecular weight of 526.52 g/mol. Its IUPAC name is 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2-propylphenoxy]butyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2-propylphenoxy]butyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235172 |
| Molecular Formula | C24H32F6N2O4 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2-propylphenoxy]butyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(OC)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)N(C)C(C)(CC)C1=O |
| InChI | InChI=1S/C24H32F6N2O4/c1-6-10-16-15-17(22(35-5,23(25,26)27)24(28,29)30)11-12-18(16)36-14-9-8-13-32-19(33)21(3,7-2)31(4)20(32)34/h11-12,15H,6-10,13-14H2,1-5H3 |
| InChIKey | SMWNQIWFIXETES-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|