C28H32F6N2O5 — CID 59234955
5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 59234955) has the molecular formula C28H32F6N2O5 and a molecular weight of 590.56 g/mol. Its IUPAC name is 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234955 |
| Molecular Formula | C28H32F6N2O5 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(CC)(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C28H32F6N2O5/c1-4-8-18-17-20(26(39,27(29,30)31)28(32,33)34)11-14-22(18)41-16-7-6-15-36-23(37)25(5-2,35-24(36)38)19-9-12-21(40-3)13-10-19/h9-14,17,39H,4-8,15-16H2,1-3H3,(H,35,38) |
| InChIKey | ZUSRAIJOSOQEQJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|