C25H26O6 — CID 87950178
4-[[3-[(E)-6-ethyl-6-hydroxyoct-2-en-4-yn-2-yl]phenoxy]methyl]phthalic acid (PubChem CID 87950178) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-[[3-[(E)-6-ethyl-6-hydroxyoct-2-en-4-yn-2-yl]phenoxy]methyl]phthalic acid.
| Compound Name | 4-[[3-[(E)-6-ethyl-6-hydroxyoct-2-en-4-yn-2-yl]phenoxy]methyl]phthalic acid |
|---|---|
| PubChem CID | 87950178 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-[[3-[(E)-6-ethyl-6-hydroxyoct-2-en-4-yn-2-yl]phenoxy]methyl]phthalic acid |
| SMILES | CCC(O)(C#C/C=C(\C)c1cccc(OCc2ccc(C(=O)O)c(C(=O)O)c2)c1)CC |
| InChI | InChI=1S/C25H26O6/c1-4-25(30,5-2)13-7-8-17(3)19-9-6-10-20(15-19)31-16-18-11-12-21(23(26)27)22(14-18)24(28)29/h6,8-12,14-15,30H,4-5,16H2,1-3H3,(H,26,27)(H,28,29)/b17-8+ |
| InChIKey | LTBACQCUBUMUNH-CAOOACKPSA-N |
| XLogP | 4.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|