C47H38N4O — CID 90723252
4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol (PubChem CID 90723252) has the molecular formula C47H38N4O and a molecular weight of 674.85 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol.
| Compound Name | 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 90723252 |
| Molecular Formula | C47H38N4O |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc([nH]3)C(c3ccc(O)cc3)=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C47H38N4O/c1-28-4-10-31(11-5-28)44-36-20-22-38(48-36)45(32-12-6-29(2)7-13-32)40-24-26-42(50-40)47(34-16-18-35(52)19-17-34)43-27-25-41(51-43)46(39-23-21-37(44)49-39)33-14-8-30(3)9-15-33/h4-27,48-52H,1-3H3 |
| InChIKey | WLXXHZIEQNBFIU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |