C23H24ClN5O2S — CID 90724043
(Z)-but-2-enoic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzonitrile (PubChem CID 90724043) has the molecular formula C23H24ClN5O2S and a molecular weight of 470.00 g/mol. Its IUPAC name is (Z)-but-2-enoic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | (Z)-but-2-enoic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 90724043 |
| Molecular Formula | C23H24ClN5O2S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (Z)-but-2-enoic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzonitrile |
| SMILES | C/C=C\C(=O)O.N#Cc1cccc(CN2CCC(Nc3ncnc4sc(Cl)cc34)CC2)c1 |
| InChI | InChI=1S/C19H18ClN5S.C4H6O2/c20-17-9-16-18(22-12-23-19(16)26-17)24-15-4-6-25(7-5-15)11-14-3-1-2-13(8-14)10-21;1-2-3-4(5)6/h1-3,8-9,12,15H,4-7,11H2,(H,22,23,24);2-3H,1H3,(H,5,6)/b;3-2- |
| InChIKey | DIYKSUVXKASFQY-AHNKWOMYSA-N |
| XLogP | 4.94 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|