C38H56O9 — CID 90724410
3-O-(1-ethylcyclopentyl) 1-O-(5-hydroxy-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 90724410) has the molecular formula C38H56O9 and a molecular weight of 656.86 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 1-O-(5-hydroxy-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 1-O-(5-hydroxy-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 90724410 |
| Molecular Formula | C38H56O9 |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 1-O-(5-hydroxy-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(CC(C)(C)C(=O)OC2C3CC4CC2CC(O)(C4)C3)CC(C)(CC)C(=O)OC2C3CC4C(=O)OC2C4C3)CCCC1 |
| InChI | InChI=1S/C38H56O9/c1-6-36(5,34(42)46-29-22-14-26-27(15-22)32(40)44-30(26)29)18-25(31(39)47-38(7-2)10-8-9-11-38)17-35(3,4)33(41)45-28-23-12-21-13-24(28)20-37(43,16-21)19-23/h21-30,43H,6-20H2,1-5H3 |
| InChIKey | AFMAQTKPKDNQDP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|