C34H52F3NO10S — CID 58403314
3-O-(1-ethylcyclopentyl) 5-O-[2-methyl-2-(trifluoromethylsulfonylamino)propyl] 1-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 58403314) has the molecular formula C34H52F3NO10S and a molecular weight of 723.85 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 5-O-[2-methyl-2-(trifluoromethylsulfonylamino)propyl] 1-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 5-O-[2-methyl-2-(trifluoromethylsulfonylamino)propyl] 1-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58403314 |
| Molecular Formula | C34H52F3NO10S |
| Molecular Weight | 723.85 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 5-O-[2-methyl-2-(trifluoromethylsulfonylamino)propyl] 1-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(C)(CC(C)(C)C(=O)OC2C3CC4C(=O)OC2C4C3)CC(C)(CC)C(=O)OCC(C)(C)NS(=O)(=O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C34H52F3NO10S/c1-9-31(7,27(41)45-19-30(5,6)38-49(43,44)34(35,36)37)18-32(8,28(42)48-33(10-2)13-11-12-14-33)17-29(3,4)26(40)47-23-20-15-21-22(16-20)25(39)46-24(21)23/h20-24,38H,9-19H2,1-8H3 |
| InChIKey | DCWFAVXEYJPYNP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.85 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|