C7H15NO — CID 90725287
1-amino-2,3-dimethylpent-3-en-1-ol (PubChem CID 90725287) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 1-amino-2,3-dimethylpent-3-en-1-ol.
| Compound Name | 1-amino-2,3-dimethylpent-3-en-1-ol |
|---|---|
| PubChem CID | 90725287 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1-amino-2,3-dimethylpent-3-en-1-ol |
| SMILES | CC=C(C)C(C)C(N)O |
| InChI | InChI=1S/C7H15NO/c1-4-5(2)6(3)7(8)9/h4,6-7,9H,8H2,1-3H3 |
| InChIKey | DHSIMXLJFNZVNH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|