C7H16N2O — CID 123254059
6,6-diamino-3-methylhex-3-en-1-ol (PubChem CID 123254059) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 6,6-diamino-3-methylhex-3-en-1-ol.
| Compound Name | 6,6-diamino-3-methylhex-3-en-1-ol |
|---|---|
| PubChem CID | 123254059 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 6,6-diamino-3-methylhex-3-en-1-ol |
| SMILES | CC(=CCC(N)N)CCO |
| InChI | InChI=1S/C7H16N2O/c1-6(4-5-10)2-3-7(8)9/h2,7,10H,3-5,8-9H2,1H3 |
| InChIKey | RPJIZTIERLCHLR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|