About CID 90725364
CID 90725364 (PubChem CID 90725364) has the molecular formula C2H5BCl2OP+
and a molecular weight of 157.75 g/mol.
Molecular Properties
| Compound Name | CID 90725364 |
| PubChem CID | 90725364 |
| Molecular Formula | C2H5BCl2OP+ |
| Molecular Weight | 157.75 g/mol |
| Exact Mass | 156.95 |
| IUPAC Name | — |
| SMILES | ClCCl.[B][P+](C)=O |
| InChI | InChI=1S/CH3BOP.CH2Cl2/c1-4(2)3;2-1-3/h1H3;1H2/q+1; |
| InChIKey | AXZRYWNNIFZYMP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.75 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 90725364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90725364?
The IUPAC name of CID 90725364 (CID 90725364) is not available.
What is the SMILES notation for CID 90725364?
The canonical SMILES for CID 90725364 is ClCCl.[B][P+](C)=O.
What is the InChIKey of CID 90725364?
The InChIKey is AXZRYWNNIFZYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3BOP.CH2Cl2/c1-4(2)3;2-1-3/h1H3;1H2/q+1;.
What are the key properties of CID 90725364?
CID 90725364 has a molecular weight of 157.75 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90725364 is sourced from PubChem (CID 90725364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).