C30H40O6 — CID 90726604
(1R,7S,15S,17R)-7-[(1S)-1-hydroxy-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13,15-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-3,8,12,19-tetraene-5,11-dione (PubChem CID 90726604) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is (1R,7S,15S,17R)-7-[(1S)-1-hydroxy-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13,15-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-3,8,12,19-tetraene-5,11-dione.
| Compound Name | (1R,7S,15S,17R)-7-[(1S)-1-hydroxy-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13,15-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-3,8,12,19-tetraene-5,11-dione |
|---|---|
| PubChem CID | 90726604 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (1R,7S,15S,17R)-7-[(1S)-1-hydroxy-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13,15-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-3,8,12,19-tetraene-5,11-dione |
| SMILES | CC1=CC(=O)CC=C[C@@H]([C@@H](O)C=C[C@@H]2CC(C)=CCO2)OC(=O)C=CC[C@@H]2C=CC[C@@H](C[C@@H](C)C1)O2 |
| InChI | InChI=1S/C30H40O6/c1-21-15-16-34-26(19-21)13-14-28(32)29-11-4-7-24(31)18-22(2)17-23(3)20-27-10-5-8-25(35-27)9-6-12-30(33)36-29/h4-6,8,11-15,18,23,25-29,32H,7,9-10,16-17,19-20H2,1-3H3/t23-,25-,26+,27-,28-,29-/m0/s1 |
| InChIKey | GSOLXDATBPTBJL-JJSLGHGJSA-N |
| XLogP | 5.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|