C19H24N2O — CID 90726650
3-(azetidin-2-ylmethoxy)-5-[2-(3-ethylphenyl)ethyl]pyridine (PubChem CID 90726650) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(azetidin-2-ylmethoxy)-5-[2-(3-ethylphenyl)ethyl]pyridine.
| Compound Name | 3-(azetidin-2-ylmethoxy)-5-[2-(3-ethylphenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 90726650 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-(azetidin-2-ylmethoxy)-5-[2-(3-ethylphenyl)ethyl]pyridine |
| SMILES | CCc1cccc(CCc2cncc(OCC3CCN3)c2)c1 |
| InChI | InChI=1S/C19H24N2O/c1-2-15-4-3-5-16(10-15)6-7-17-11-19(13-20-12-17)22-14-18-8-9-21-18/h3-5,10-13,18,21H,2,6-9,14H2,1H3 |
| InChIKey | QUNDYWAOJPTRPD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |