C30H38N6O7S — CID 90727829
[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl] propanoate (PubChem CID 90727829) has the molecular formula C30H38N6O7S and a molecular weight of 626.74 g/mol. Its IUPAC name is [6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl] propanoate.
| Compound Name | [6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl] propanoate |
|---|---|
| PubChem CID | 90727829 |
| Molecular Formula | C30H38N6O7S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | [6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl] propanoate |
| SMILES | CCC(=O)OC1=Cc2nn(Cc3ncc(C)c(OC)c3C)c3nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc(c23)SC1 |
| InChI | InChI=1S/C30H38N6O7S/c1-11-21(37)41-18-12-19-22-24(35(34-19)14-20-17(3)23(40-10)16(2)13-31-20)32-26(33-25(22)44-15-18)36(27(38)42-29(4,5)6)28(39)43-30(7,8)9/h12-13H,11,14-15H2,1-10H3 |
| InChIKey | QLSPLUGBCCTQRY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 147.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|