C8H14N2 — CID 90728024
3-(3-methylbut-2-enyl)-1,2-dihydroimidazole (PubChem CID 90728024) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-1,2-dihydroimidazole.
| Compound Name | 3-(3-methylbut-2-enyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 90728024 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-1,2-dihydroimidazole |
| SMILES | CC(C)=CCN1C=CNC1 |
| InChI | InChI=1S/C8H14N2/c1-8(2)3-5-10-6-4-9-7-10/h3-4,6,9H,5,7H2,1-2H3 |
| InChIKey | UDHSGCKNRDYIAB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|