C11H12F3NO3S — CID 90728463
2-methyl-3,4-dihydroisoquinolin-2-ium;trifluoromethanesulfonate (PubChem CID 90728463) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-methyl-3,4-dihydroisoquinolin-2-ium;trifluoromethanesulfonate.
| Compound Name | 2-methyl-3,4-dihydroisoquinolin-2-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90728463 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-methyl-3,4-dihydroisoquinolin-2-ium;trifluoromethanesulfonate |
| SMILES | C[N+]1=Cc2ccccc2CC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H12N.CHF3O3S/c1-11-7-6-9-4-2-3-5-10(9)8-11;2-1(3,4)8(5,6)7/h2-5,8H,6-7H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | RUITUFXNWMVZMX-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|