C26H26N2O4 — CID 90729114
3-[2-[[6-(3-ethoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-3,5-dimethylpyrrol-1-yl]propanoic acid (PubChem CID 90729114) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 3-[2-[[6-(3-ethoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-3,5-dimethylpyrrol-1-yl]propanoic acid.
| Compound Name | 3-[2-[[6-(3-ethoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-3,5-dimethylpyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 90729114 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-[2-[[6-(3-ethoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-3,5-dimethylpyrrol-1-yl]propanoic acid |
| SMILES | CCOc1cccc(-c2ccc3c(c2)NC(=O)C3=Cc2c(C)cc(C)n2CCC(=O)O)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-4-32-20-7-5-6-18(13-20)19-8-9-21-22(26(31)27-23(21)14-19)15-24-16(2)12-17(3)28(24)11-10-25(29)30/h5-9,12-15H,4,10-11H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | FWRIYQFJWYGPNU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|