C23H26N6S — CID 90729546
2-[5-methyl-2-(3-pyrrolidin-1-ylpropylamino)pyrimidin-4-yl]-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 90729546) has the molecular formula C23H26N6S and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[5-methyl-2-(3-pyrrolidin-1-ylpropylamino)pyrimidin-4-yl]-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-[5-methyl-2-(3-pyrrolidin-1-ylpropylamino)pyrimidin-4-yl]-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 90729546 |
| Molecular Formula | C23H26N6S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[5-methyl-2-(3-pyrrolidin-1-ylpropylamino)pyrimidin-4-yl]-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | Cc1cnc(NCCCN2CCCC2)nc1C(C#N)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H26N6S/c1-17-15-26-23(25-10-7-13-29-11-5-6-12-29)28-21(17)19(14-24)22-27-20(16-30-22)18-8-3-2-4-9-18/h2-4,8-9,15-16,19H,5-7,10-13H2,1H3,(H,25,26,28) |
| InChIKey | RBRPQFGETGPWMY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|