C23H25ClN6S — CID 90730494
9-chloro-2-[[2-methyl-5-[4-(methylamino)butyl]-3-pyridinyl]amino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione (PubChem CID 90730494) has the molecular formula C23H25ClN6S and a molecular weight of 453.02 g/mol. Its IUPAC name is 9-chloro-2-[[2-methyl-5-[4-(methylamino)butyl]-3-pyridinyl]amino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione.
| Compound Name | 9-chloro-2-[[2-methyl-5-[4-(methylamino)butyl]-3-pyridinyl]amino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
|---|---|
| PubChem CID | 90730494 |
| Molecular Formula | C23H25ClN6S |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 9-chloro-2-[[2-methyl-5-[4-(methylamino)butyl]-3-pyridinyl]amino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| SMILES | CNCCCCc1cnc(C)c(Nc2ncc3c(n2)-c2ccc(Cl)cc2NC(=S)C3)c1 |
| InChI | InChI=1S/C23H25ClN6S/c1-14-19(9-15(12-26-14)5-3-4-8-25-2)29-23-27-13-16-10-21(31)28-20-11-17(24)6-7-18(20)22(16)30-23/h6-7,9,11-13,25H,3-5,8,10H2,1-2H3,(H,28,31)(H,27,29,30) |
| InChIKey | OTYSQBUBAVMXPJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|