C24H26ClN5OS — CID 56945273
9-chloro-2-[3-[3-(dimethylamino)propyl]-4-methoxyanilino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione (PubChem CID 56945273) has the molecular formula C24H26ClN5OS and a molecular weight of 468.03 g/mol. Its IUPAC name is 9-chloro-2-[3-[3-(dimethylamino)propyl]-4-methoxyanilino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione.
| Compound Name | 9-chloro-2-[3-[3-(dimethylamino)propyl]-4-methoxyanilino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
|---|---|
| PubChem CID | 56945273 |
| Molecular Formula | C24H26ClN5OS |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 9-chloro-2-[3-[3-(dimethylamino)propyl]-4-methoxyanilino]-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| SMILES | COc1ccc(Nc2ncc3c(n2)-c2ccc(Cl)cc2NC(=S)C3)cc1CCCN(C)C |
| InChI | InChI=1S/C24H26ClN5OS/c1-30(2)10-4-5-15-11-18(7-9-21(15)31-3)27-24-26-14-16-12-22(32)28-20-13-17(25)6-8-19(20)23(16)29-24/h6-9,11,13-14H,4-5,10,12H2,1-3H3,(H,28,32)(H,26,27,29) |
| InChIKey | ABXJJVJJEAFTLI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|