C21H21ClN6S — CID 91058335
9-chloro-10-[3-(methylamino)propyl]-2-(pyridin-3-ylamino)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione (PubChem CID 91058335) has the molecular formula C21H21ClN6S and a molecular weight of 424.96 g/mol. Its IUPAC name is 9-chloro-10-[3-(methylamino)propyl]-2-(pyridin-3-ylamino)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione.
| Compound Name | 9-chloro-10-[3-(methylamino)propyl]-2-(pyridin-3-ylamino)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
|---|---|
| PubChem CID | 91058335 |
| Molecular Formula | C21H21ClN6S |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 9-chloro-10-[3-(methylamino)propyl]-2-(pyridin-3-ylamino)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| SMILES | CNCCCc1cc2c(cc1Cl)NC(=S)Cc1cnc(Nc3cccnc3)nc1-2 |
| InChI | InChI=1S/C21H21ClN6S/c1-23-6-2-4-13-8-16-18(10-17(13)22)27-19(29)9-14-11-25-21(28-20(14)16)26-15-5-3-7-24-12-15/h3,5,7-8,10-12,23H,2,4,6,9H2,1H3,(H,27,29)(H,25,26,28) |
| InChIKey | OTPOOGDOLSFUPQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|