C26H25N5OS — CID 143213884
2-[3-[3-(methylamino)propyl]anilino]-9-thiophen-3-yl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 143213884) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 2-[3-[3-(methylamino)propyl]anilino]-9-thiophen-3-yl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 2-[3-[3-(methylamino)propyl]anilino]-9-thiophen-3-yl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 143213884 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-[3-[3-(methylamino)propyl]anilino]-9-thiophen-3-yl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | CNCCCc1cccc(Nc2ncc3c(n2)-c2ccc(-c4ccsc4)cc2NC(=O)C3)c1 |
| InChI | InChI=1S/C26H25N5OS/c1-27-10-3-5-17-4-2-6-21(12-17)29-26-28-15-20-14-24(32)30-23-13-18(19-9-11-33-16-19)7-8-22(23)25(20)31-26/h2,4,6-9,11-13,15-16,27H,3,5,10,14H2,1H3,(H,30,32)(H,28,29,31) |
| InChIKey | FJOBMBBJAAQYIE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|