About [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid
[(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid (PubChem CID 90731051) has the molecular formula C23H30N2O5S
and a molecular weight of 446.57 g/mol. Its IUPAC name is [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid |
| PubChem CID | 90731051 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid |
| SMILES | Cc1ccc(C)c(COC2CCN(S(=O)(=O)C[C@H](NC(=O)O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H30N2O5S/c1-17-8-9-18(2)20(14-17)15-30-21-10-12-25(13-11-21)31(28,29)16-22(24-23(26)27)19-6-4-3-5-7-19/h3-9,14,21-22,24H,10-13,15-16H2,1-2H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | LLKBZEZVXRQYIU-QFIPXVFZSA-N |
| XLogP | 3.62 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid?
The IUPAC name of [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid (CID 90731051) is [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid.
What is the SMILES notation for [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid?
The canonical SMILES for [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid is Cc1ccc(C)c(COC2CCN(S(=O)(=O)C[C@H](NC(=O)O)c3ccccc3)CC2)c1.
What is the InChIKey of [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid?
The InChIKey is LLKBZEZVXRQYIU-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H30N2O5S/c1-17-8-9-18(2)20(14-17)15-30-21-10-12-25(13-11-21)31(28,29)16-22(24-23(26)27)19-6-4-3-5-7-19/h3-9,14,21-22,24H,10-13,15-16H2,1-2H3,(H,26,27)/t22-/m0/s1.
What are the key properties of [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid?
[(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid has a molecular weight of 446.57 g/mol, XLogP of 3.62, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-1-phenylethyl]carbamic acid is sourced from PubChem (CID 90731051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).