C25H30F3N3O2 — CID 90731501
2-[[hydroxy-[3-(trifluoromethyl)phenyl]methyl]amino]-N-[1-(4-phenylcyclohexyl)azetidin-3-yl]acetamide (PubChem CID 90731501) has the molecular formula C25H30F3N3O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[[hydroxy-[3-(trifluoromethyl)phenyl]methyl]amino]-N-[1-(4-phenylcyclohexyl)azetidin-3-yl]acetamide.
| Compound Name | 2-[[hydroxy-[3-(trifluoromethyl)phenyl]methyl]amino]-N-[1-(4-phenylcyclohexyl)azetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 90731501 |
| Molecular Formula | C25H30F3N3O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[[hydroxy-[3-(trifluoromethyl)phenyl]methyl]amino]-N-[1-(4-phenylcyclohexyl)azetidin-3-yl]acetamide |
| SMILES | O=C(CNC(O)c1cccc(C(F)(F)F)c1)NC1CN(C2CCC(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C25H30F3N3O2/c26-25(27,28)20-8-4-7-19(13-20)24(33)29-14-23(32)30-21-15-31(16-21)22-11-9-18(10-12-22)17-5-2-1-3-6-17/h1-8,13,18,21-22,24,29,33H,9-12,14-16H2,(H,30,32) |
| InChIKey | BIDXKWZWYWMNMT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|