C29H48O5S — CID 90731744
5-[2-[(1S,3aS,7aS)-1-[(1R)-1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 90731744) has the molecular formula C29H48O5S and a molecular weight of 508.77 g/mol. Its IUPAC name is 5-[2-[(1S,3aS,7aS)-1-[(1R)-1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | 5-[2-[(1S,3aS,7aS)-1-[(1R)-1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 90731744 |
| Molecular Formula | C29H48O5S |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 5-[2-[(1S,3aS,7aS)-1-[(1R)-1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@@H](C)OCCCCS(=O)(=O)C(C)(C)C)CC[C@@H]23)CC(O)CC1O |
| InChI | InChI=1S/C29H48O5S/c1-20-23(18-24(30)19-27(20)31)12-11-22-10-9-15-29(6)25(13-14-26(22)29)21(2)34-16-7-8-17-35(32,33)28(3,4)5/h11-12,21,24-27,30-31H,1,7-10,13-19H2,2-6H3/t21-,24?,25-,26+,27?,29-/m1/s1 |
| InChIKey | CPXYNGXASSCPTA-DFNFKNLOSA-N |
| XLogP | 5.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|