C29H44O4S — CID 90702723
5-[2-[(1R,3aS,7aR)-1-[(2R)-6-tert-butylsulfonylhexa-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 90702723) has the molecular formula C29H44O4S and a molecular weight of 488.73 g/mol. Its IUPAC name is 5-[2-[(1R,3aS,7aR)-1-[(2R)-6-tert-butylsulfonylhexa-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | 5-[2-[(1R,3aS,7aR)-1-[(2R)-6-tert-butylsulfonylhexa-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 90702723 |
| Molecular Formula | C29H44O4S |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 5-[2-[(1R,3aS,7aR)-1-[(2R)-6-tert-butylsulfonylhexa-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)C=CC=CS(=O)(=O)C(C)(C)C)CC[C@@H]23)CC(O)CC1O |
| InChI | InChI=1S/C29H44O4S/c1-20(10-7-8-17-34(32,33)28(3,4)5)25-14-15-26-22(11-9-16-29(25,26)6)12-13-23-18-24(30)19-27(31)21(23)2/h7-8,10,12-13,17,20,24-27,30-31H,2,9,11,14-16,18-19H2,1,3-6H3/t20-,24?,25-,26+,27?,29-/m1/s1 |
| InChIKey | QRPIVLFHDZUNSP-PWVZABKGSA-N |
| XLogP | 6.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|