C24H27N5O4 — CID 90732484
carbamoyl 1-[3-[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]-3-methylpyrrolidine-3-carboxylate (PubChem CID 90732484) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is carbamoyl 1-[3-[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]-3-methylpyrrolidine-3-carboxylate.
| Compound Name | carbamoyl 1-[3-[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]-3-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 90732484 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | carbamoyl 1-[3-[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]-3-methylpyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(-c3cccc(N4CCC(C)(C(=O)OC(N)=O)C4)c3)nc12 |
| InChI | InChI=1S/C24H27N5O4/c1-23(2,3)19(30)16-11-26-20-18(16)28-17(12-27-20)14-6-5-7-15(10-14)29-9-8-24(4,13-29)21(31)33-22(25)32/h5-7,10-12H,8-9,13H2,1-4H3,(H2,25,32)(H,26,27) |
| InChIKey | HAKZUHJCMKEATL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|