C29H31ClN4O3 — CID 90733102
4-(2-aminoethoxymethyl)-6-(3-chlorophenyl)-N-(3,3-diphenylpropyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 90733102) has the molecular formula C29H31ClN4O3 and a molecular weight of 519.05 g/mol. Its IUPAC name is 4-(2-aminoethoxymethyl)-6-(3-chlorophenyl)-N-(3,3-diphenylpropyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(2-aminoethoxymethyl)-6-(3-chlorophenyl)-N-(3,3-diphenylpropyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90733102 |
| Molecular Formula | C29H31ClN4O3 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-(2-aminoethoxymethyl)-6-(3-chlorophenyl)-N-(3,3-diphenylpropyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | NCCOCC1=NC(=O)NC(c2cccc(Cl)c2)C1C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31ClN4O3/c30-23-13-7-12-22(18-23)27-26(25(19-37-17-15-31)33-29(36)34-27)28(35)32-16-14-24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,24,26-27H,14-17,19,31H2,(H,32,35)(H,34,36) |
| InChIKey | WZBAJSMXVXKRFE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|