C11H16O4 — CID 90733899
dimethyl 2,5,5-trideuterio-3,4-dimethylcyclopent-2-ene-1,1-dicarboxylate (PubChem CID 90733899) has the molecular formula C11H16O4 and a molecular weight of 215.26 g/mol. Its IUPAC name is dimethyl 2,5,5-trideuterio-3,4-dimethylcyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 2,5,5-trideuterio-3,4-dimethylcyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 90733899 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | dimethyl 2,5,5-trideuterio-3,4-dimethylcyclopent-2-ene-1,1-dicarboxylate |
| SMILES | [2H]C1=C(C)C(C)C([2H])([2H])C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H16O4/c1-7-5-11(6-8(7)2,9(12)14-3)10(13)15-4/h5,8H,6H2,1-4H3/i5D,6D2 |
| InChIKey | AOIPBNPRSYWDDQ-FFTSUDIOSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|