C21H45O5P — CID 90734732
bis(2-methylbutyl) 2,4,4-trimethylpentyl phosphate;propanal (PubChem CID 90734732) has the molecular formula C21H45O5P and a molecular weight of 408.56 g/mol. Its IUPAC name is bis(2-methylbutyl) 2,4,4-trimethylpentyl phosphate;propanal.
| Compound Name | bis(2-methylbutyl) 2,4,4-trimethylpentyl phosphate;propanal |
|---|---|
| PubChem CID | 90734732 |
| Molecular Formula | C21H45O5P |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | bis(2-methylbutyl) 2,4,4-trimethylpentyl phosphate;propanal |
| SMILES | CCC(C)COP(=O)(OCC(C)CC)OCC(C)CC(C)(C)C.CCC=O |
| InChI | InChI=1S/C18H39O4P.C3H6O/c1-9-15(3)12-20-23(19,21-13-16(4)10-2)22-14-17(5)11-18(6,7)8;1-2-3-4/h15-17H,9-14H2,1-8H3;3H,2H2,1H3 |
| InChIKey | BRIFDPBKEIKVNJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|