C21H48NO5P — CID 118952390
bis(2,4,4-trimethylpentyl) phosphate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 118952390) has the molecular formula C21H48NO5P and a molecular weight of 425.59 g/mol. Its IUPAC name is bis(2,4,4-trimethylpentyl) phosphate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | bis(2,4,4-trimethylpentyl) phosphate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 118952390 |
| Molecular Formula | C21H48NO5P |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | bis(2,4,4-trimethylpentyl) phosphate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(COP(=O)([O-])OCC(C)CC(C)(C)C)CC(C)(C)C.C[N+](C)(C)CCO |
| InChI | InChI=1S/C16H35O4P.C5H14NO/c1-13(9-15(3,4)5)11-19-21(17,18)20-12-14(2)10-16(6,7)8;1-6(2,3)4-5-7/h13-14H,9-12H2,1-8H3,(H,17,18);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | PMKCYSJBXGRANC-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|