C12H34ClN2O6PSi — CID 88647845
[chloro(dimethyl)silyl] phosphate;bis(2-hydroxyethyl(trimethyl)azanium) (PubChem CID 88647845) has the molecular formula C12H34ClN2O6PSi and a molecular weight of 396.93 g/mol. Its IUPAC name is [chloro(dimethyl)silyl] phosphate;bis(2-hydroxyethyl(trimethyl)azanium).
| Compound Name | [chloro(dimethyl)silyl] phosphate;bis(2-hydroxyethyl(trimethyl)azanium) |
|---|---|
| PubChem CID | 88647845 |
| Molecular Formula | C12H34ClN2O6PSi |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [chloro(dimethyl)silyl] phosphate;bis(2-hydroxyethyl(trimethyl)azanium) |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.C[Si](C)(Cl)OP(=O)([O-])[O-] |
| InChI | InChI=1S/2C5H14NO.C2H8ClO4PSi/c2*1-6(2,3)4-5-7;1-9(2,3)7-8(4,5)6/h2*7H,4-5H2,1-3H3;1-2H3,(H2,4,5,6)/q2*+1;/p-2 |
| InChIKey | YRASPOOXUUGDGV-UHFFFAOYSA-L |
| XLogP | -0.86 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|