C16H34O2P- — CID 86306261
bis[(2S)-2,4,4-trimethylpentyl]phosphinate (PubChem CID 86306261) has the molecular formula C16H34O2P- and a molecular weight of 289.42 g/mol. Its IUPAC name is bis[(2S)-2,4,4-trimethylpentyl]phosphinate.
| Compound Name | bis[(2S)-2,4,4-trimethylpentyl]phosphinate |
|---|---|
| PubChem CID | 86306261 |
| Molecular Formula | C16H34O2P- |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | bis[(2S)-2,4,4-trimethylpentyl]phosphinate |
| SMILES | C[C@@H](CC(C)(C)C)CP(=O)([O-])C[C@@H](C)CC(C)(C)C |
| InChI | InChI=1S/C16H35O2P/c1-13(9-15(3,4)5)11-19(17,18)12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3,(H,17,18)/p-1/t13-,14-/m0/s1 |
| InChIKey | QUXFOKCUIZCKGS-KBPBESRZSA-M |
| XLogP | 4.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|