C29H64O2P2 — CID 87080900
bis(2,4,4-trimethylpentyl)phosphinate;tributyl(methyl)phosphanium (PubChem CID 87080900) has the molecular formula C29H64O2P2 and a molecular weight of 506.78 g/mol. Its IUPAC name is bis(2,4,4-trimethylpentyl)phosphinate;tributyl(methyl)phosphanium.
| Compound Name | bis(2,4,4-trimethylpentyl)phosphinate;tributyl(methyl)phosphanium |
|---|---|
| PubChem CID | 87080900 |
| Molecular Formula | C29H64O2P2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.44 |
| IUPAC Name | bis(2,4,4-trimethylpentyl)phosphinate;tributyl(methyl)phosphanium |
| SMILES | CC(CC(C)(C)C)CP(=O)([O-])CC(C)CC(C)(C)C.CCCC[P+](C)(CCCC)CCCC |
| InChI | InChI=1S/C16H35O2P.C13H30P/c1-13(9-15(3,4)5)11-19(17,18)12-14(2)10-16(6,7)8;1-5-8-11-14(4,12-9-6-2)13-10-7-3/h13-14H,9-12H2,1-8H3,(H,17,18);5-13H2,1-4H3/q;+1/p-1 |
| InChIKey | IYHOZJJTTGBJTD-UHFFFAOYSA-M |
| XLogP | 9.80 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|