C32H70O4P2 — CID 158880540
2-ethylhexyl(2,4,4-trimethylpentan-2-yl)phosphinic acid;2,4,4-trimethylpentan-2-yl(2,4,4-trimethylpentyl)phosphinic acid (PubChem CID 158880540) has the molecular formula C32H70O4P2 and a molecular weight of 580.86 g/mol. Its IUPAC name is 2-ethylhexyl(2,4,4-trimethylpentan-2-yl)phosphinic acid;2,4,4-trimethylpentan-2-yl(2,4,4-trimethylpentyl)phosphinic acid.
| Compound Name | 2-ethylhexyl(2,4,4-trimethylpentan-2-yl)phosphinic acid;2,4,4-trimethylpentan-2-yl(2,4,4-trimethylpentyl)phosphinic acid |
|---|---|
| PubChem CID | 158880540 |
| Molecular Formula | C32H70O4P2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.47 |
| IUPAC Name | 2-ethylhexyl(2,4,4-trimethylpentan-2-yl)phosphinic acid;2,4,4-trimethylpentan-2-yl(2,4,4-trimethylpentyl)phosphinic acid |
| SMILES | CC(CC(C)(C)C)CP(=O)(O)C(C)(C)CC(C)(C)C.CCCCC(CC)CP(=O)(O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/2C16H35O2P/c1-13(10-14(2,3)4)11-19(17,18)16(8,9)12-15(5,6)7;1-8-10-11-14(9-2)12-19(17,18)16(6,7)13-15(3,4)5/h13H,10-12H2,1-9H3,(H,17,18);14H,8-13H2,1-7H3,(H,17,18) |
| InChIKey | JCYZTRAQZDHRHD-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|