C10H10O2 — CID 90735568
4-methoxy-2-propa-1,2-dienylphenol (PubChem CID 90735568) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-methoxy-2-propa-1,2-dienylphenol.
| Compound Name | 4-methoxy-2-propa-1,2-dienylphenol |
|---|---|
| PubChem CID | 90735568 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 4-methoxy-2-propa-1,2-dienylphenol |
| SMILES | C=C=Cc1cc(OC)ccc1O |
| InChI | InChI=1S/C10H10O2/c1-3-4-8-7-9(12-2)5-6-10(8)11/h4-7,11H,1H2,2H3 |
| InChIKey | PREMTLNWAODLMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |