C27H29FN2O4 — CID 90735872
[4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl] 3-fluoro-5-piperidin-1-ylbenzoate (PubChem CID 90735872) has the molecular formula C27H29FN2O4 and a molecular weight of 464.54 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl] 3-fluoro-5-piperidin-1-ylbenzoate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl] 3-fluoro-5-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 90735872 |
| Molecular Formula | C27H29FN2O4 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-1-yl] 3-fluoro-5-piperidin-1-ylbenzoate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OC(=O)c2cc(F)cc(N3CCCCC3)c2)c2ccccc12 |
| InChI | InChI=1S/C27H29FN2O4/c1-27(2,3)34-26(32)29-23-11-12-24(22-10-6-5-9-21(22)23)33-25(31)18-15-19(28)17-20(16-18)30-13-7-4-8-14-30/h5-6,9-12,15-17H,4,7-8,13-14H2,1-3H3,(H,29,32) |
| InChIKey | SDSMBAPFOBKLBO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|