C33H46N4O5 — CID 90736529
benzyl N-[1-[[3-[(butan-2-ylamino)-hydroxymethyl]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]amino]-3-(4-methylphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 90736529) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is benzyl N-[1-[[3-[(butan-2-ylamino)-hydroxymethyl]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]amino]-3-(4-methylphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-[(butan-2-ylamino)-hydroxymethyl]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]amino]-3-(4-methylphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90736529 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | benzyl N-[1-[[3-[(butan-2-ylamino)-hydroxymethyl]-5-oxo-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]amino]-3-(4-methylphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCC(C)NC(O)C1CCC2CCCCC(NC(=O)C(Cc3ccc(C)cc3)NC(=O)OCc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C33H46N4O5/c1-4-23(3)34-31(39)29-19-18-26-12-8-9-13-27(32(40)37(26)29)35-30(38)28(20-24-16-14-22(2)15-17-24)36-33(41)42-21-25-10-6-5-7-11-25/h5-7,10-11,14-17,23,26-29,31,34,39H,4,8-9,12-13,18-21H2,1-3H3,(H,35,38)(H,36,41) |
| InChIKey | NRMHZKJUOVIWDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|