C38H57N3O5 — CID 90776419
benzyl N-[6-[3-[hydroxy-(6-hydroxyhexylamino)methyl]-1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-a]azocin-6-yl]-1-(4-methylphenyl)-3-oxohexan-2-yl]carbamate (PubChem CID 90776419) has the molecular formula C38H57N3O5 and a molecular weight of 635.89 g/mol. Its IUPAC name is benzyl N-[6-[3-[hydroxy-(6-hydroxyhexylamino)methyl]-1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-a]azocin-6-yl]-1-(4-methylphenyl)-3-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[6-[3-[hydroxy-(6-hydroxyhexylamino)methyl]-1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-a]azocin-6-yl]-1-(4-methylphenyl)-3-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 90776419 |
| Molecular Formula | C38H57N3O5 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.43 |
| IUPAC Name | benzyl N-[6-[3-[hydroxy-(6-hydroxyhexylamino)methyl]-1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-a]azocin-6-yl]-1-(4-methylphenyl)-3-oxohexan-2-yl]carbamate |
| SMILES | Cc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)CCCC2CCCCC3CCC(C(O)NCCCCCCO)N3C2)cc1 |
| InChI | InChI=1S/C38H57N3O5/c1-29-18-20-30(21-19-29)26-34(40-38(45)46-28-32-13-5-4-6-14-32)36(43)17-11-15-31-12-7-8-16-33-22-23-35(41(33)27-31)37(44)39-24-9-2-3-10-25-42/h4-6,13-14,18-21,31,33-35,37,39,42,44H,2-3,7-12,15-17,22-28H2,1H3,(H,40,45) |
| InChIKey | GCXJZOVHYNVQJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|