C22H24N2O5 — CID 10250137
benzyl N-[(2S)-1-[[(2S)-1-[(2S)-oxiran-2-yl]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 10250137) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[(2S)-oxiran-2-yl]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[(2S)-oxiran-2-yl]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10250137 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[(2S)-oxiran-2-yl]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)[C@@H]1CO1 |
| InChI | InChI=1S/C22H24N2O5/c1-15(20(25)19-14-28-19)23-21(26)18(12-16-8-4-2-5-9-16)24-22(27)29-13-17-10-6-3-7-11-17/h2-11,15,18-19H,12-14H2,1H3,(H,23,26)(H,24,27)/t15-,18-,19-/m0/s1 |
| InChIKey | OHNZSROUOCNVBP-SNRMKQJTSA-N |
| XLogP | 2.00 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|